C17H15F2NO4 — CID 18117689
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(difluoromethoxy)benzamide (PubChem CID 18117689) has the molecular formula C17H15F2NO4 and a molecular weight of 335.31 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(difluoromethoxy)benzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 18117689 |
| Molecular Formula | C17H15F2NO4 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-(difluoromethoxy)benzamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H15F2NO4/c18-17(19)24-13-4-2-12(3-5-13)16(21)20-8-7-11-1-6-14-15(9-11)23-10-22-14/h1-6,9,17H,7-8,10H2,(H,20,21) |
| InChIKey | RMSGWRCUUSWIJU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |