C20H23F2NO4 — CID 26120167
N-[2-(3,4-diethoxyphenyl)ethyl]-4-(difluoromethoxy)benzamide (PubChem CID 26120167) has the molecular formula C20H23F2NO4 and a molecular weight of 379.40 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-(difluoromethoxy)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 26120167 |
| Molecular Formula | C20H23F2NO4 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(difluoromethoxy)benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(OC(F)F)cc2)cc1OCC |
| InChI | InChI=1S/C20H23F2NO4/c1-3-25-17-10-5-14(13-18(17)26-4-2)11-12-23-19(24)15-6-8-16(9-7-15)27-20(21)22/h5-10,13,20H,3-4,11-12H2,1-2H3,(H,23,24) |
| InChIKey | XZBHFAHTVLAWKZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |