C24H29F2NO7 — CID 55397617
[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate (PubChem CID 55397617) has the molecular formula C24H29F2NO7 and a molecular weight of 481.49 g/mol. Its IUPAC name is [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 55397617 |
| Molecular Formula | C24H29F2NO7 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)OCC(=O)NCCc2ccc(OC(F)F)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H29F2NO7/c1-4-30-19-13-17(14-20(31-5-2)22(19)32-6-3)23(29)33-15-21(28)27-12-11-16-7-9-18(10-8-16)34-24(25)26/h7-10,13-14,24H,4-6,11-12,15H2,1-3H3,(H,27,28) |
| InChIKey | NFTAOCRFRCFGDZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |