C17H19F2NO6 — CID 9015453
4-O-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 9015453) has the molecular formula C17H19F2NO6 and a molecular weight of 371.34 g/mol. Its IUPAC name is 4-O-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 9015453 |
| Molecular Formula | C17H19F2NO6 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-O-[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H19F2NO6/c1-2-24-15(22)7-8-16(23)25-11-14(21)20-10-9-12-3-5-13(6-4-12)26-17(18)19/h3-8,17H,2,9-11H2,1H3,(H,20,21)/b8-7+ |
| InChIKey | JHMILGNLBMTPTG-BQYQJAHWSA-N |
| XLogP | 1.61 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|