C20H18ClF2NO4 — CID 9286165
[2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate (PubChem CID 9286165) has the molecular formula C20H18ClF2NO4 and a molecular weight of 409.82 g/mol. Its IUPAC name is [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9286165 |
| Molecular Formula | C20H18ClF2NO4 |
| Molecular Weight | 409.82 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | [2-[2-[4-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl] (E)-3-(3-chlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc(Cl)c1)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H18ClF2NO4/c21-16-3-1-2-15(12-16)6-9-19(26)27-13-18(25)24-11-10-14-4-7-17(8-5-14)28-20(22)23/h1-9,12,20H,10-11,13H2,(H,24,25)/b9-6+ |
| InChIKey | ISFAQKHUZFCBIO-RMKNXTFCSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|