C18H15Cl2F2NO2 — CID 7613581
(E)-3-(3,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide (PubChem CID 7613581) has the molecular formula C18H15Cl2F2NO2 and a molecular weight of 386.23 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 7613581 |
| Molecular Formula | C18H15Cl2F2NO2 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[2-[4-(difluoromethoxy)phenyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H15Cl2F2NO2/c19-15-7-3-13(11-16(15)20)4-8-17(24)23-10-9-12-1-5-14(6-2-12)25-18(21)22/h1-8,11,18H,9-10H2,(H,23,24)/b8-4+ |
| InChIKey | HVZCVRVORHWLSQ-XBXARRHUSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|