C16H15F2NO2S — CID 26189419
(E)-3-[4-(difluoromethoxy)phenyl]-N-(2-thiophen-2-ylethyl)prop-2-enamide (PubChem CID 26189419) has the molecular formula C16H15F2NO2S and a molecular weight of 323.36 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-(2-thiophen-2-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(2-thiophen-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 26189419 |
| Molecular Formula | C16H15F2NO2S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(2-thiophen-2-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)NCCc1cccs1 |
| InChI | InChI=1S/C16H15F2NO2S/c17-16(18)21-13-6-3-12(4-7-13)5-8-15(20)19-10-9-14-2-1-11-22-14/h1-8,11,16H,9-10H2,(H,19,20)/b8-5+ |
| InChIKey | YAFCGWSOGMZWJS-VMPITWQZSA-N |
| XLogP | 3.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|