C16H14F2N2O2 — CID 8895534
(E)-3-[4-(difluoromethoxy)phenyl]-N-(pyridin-2-ylmethyl)prop-2-enamide (PubChem CID 8895534) has the molecular formula C16H14F2N2O2 and a molecular weight of 304.30 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-N-(pyridin-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(pyridin-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 8895534 |
| Molecular Formula | C16H14F2N2O2 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-N-(pyridin-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OC(F)F)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C16H14F2N2O2/c17-16(18)22-14-7-4-12(5-8-14)6-9-15(21)20-11-13-3-1-2-10-19-13/h1-10,16H,11H2,(H,20,21)/b9-6+ |
| InChIKey | VKONCEHGRNVCGA-RMKNXTFCSA-N |
| XLogP | 3.01 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|