C12H14N2O — CID 76860381
N-(pyridin-2-ylmethyl)hexa-2,4-dienamide (PubChem CID 76860381) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)hexa-2,4-dienamide.
| Compound Name | N-(pyridin-2-ylmethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 76860381 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N-(pyridin-2-ylmethyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)NCc1ccccn1 |
| InChI | InChI=1S/C12H14N2O/c1-2-3-4-8-12(15)14-10-11-7-5-6-9-13-11/h2-9H,10H2,1H3,(H,14,15) |
| InChIKey | NVVIVWGLOHDMHY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|