C11H11F3N2O — CID 123609120
4,4,4-trifluoro-3-methyl-N-(pyridin-2-ylmethyl)but-2-enamide (PubChem CID 123609120) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-methyl-N-(pyridin-2-ylmethyl)but-2-enamide.
| Compound Name | 4,4,4-trifluoro-3-methyl-N-(pyridin-2-ylmethyl)but-2-enamide |
|---|---|
| PubChem CID | 123609120 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4,4,4-trifluoro-3-methyl-N-(pyridin-2-ylmethyl)but-2-enamide |
| SMILES | CC(=CC(=O)NCc1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O/c1-8(11(12,13)14)6-10(17)16-7-9-4-2-3-5-15-9/h2-6H,7H2,1H3,(H,16,17) |
| InChIKey | UJGWZAZNDMGZKW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|