C17H20N4O2 — CID 108963334
2,2-dimethyl-N,N'-bis(pyridin-2-ylmethyl)propanediamide (PubChem CID 108963334) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2,2-dimethyl-N,N'-bis(pyridin-2-ylmethyl)propanediamide.
| Compound Name | 2,2-dimethyl-N,N'-bis(pyridin-2-ylmethyl)propanediamide |
|---|---|
| PubChem CID | 108963334 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2,2-dimethyl-N,N'-bis(pyridin-2-ylmethyl)propanediamide |
| SMILES | CC(C)(C(=O)NCc1ccccn1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C17H20N4O2/c1-17(2,15(22)20-11-13-7-3-5-9-18-13)16(23)21-12-14-8-4-6-10-19-14/h3-10H,11-12H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | QBBPXOCXISHANG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|