C16H14F4N4O2 — CID 2164897
2,2,3,3-tetrafluoro-N,N'-bis(pyridin-2-ylmethyl)butanediamide (PubChem CID 2164897) has the molecular formula C16H14F4N4O2 and a molecular weight of 370.31 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N,N'-bis(pyridin-2-ylmethyl)butanediamide.
| Compound Name | 2,2,3,3-tetrafluoro-N,N'-bis(pyridin-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 2164897 |
| Molecular Formula | C16H14F4N4O2 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N,N'-bis(pyridin-2-ylmethyl)butanediamide |
| SMILES | O=C(NCc1ccccn1)C(F)(F)C(F)(F)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C16H14F4N4O2/c17-15(18,13(25)23-9-11-5-1-3-7-21-11)16(19,20)14(26)24-10-12-6-2-4-8-22-12/h1-8H,9-10H2,(H,23,25)(H,24,26) |
| InChIKey | AZMRZRDJGSMTKA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|