About N-benzyl-N'-(pyridin-2-ylmethyl)oxamide
N-benzyl-N'-(pyridin-2-ylmethyl)oxamide (PubChem CID 3109924) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is N-benzyl-N'-(pyridin-2-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N-benzyl-N'-(pyridin-2-ylmethyl)oxamide |
| PubChem CID | 3109924 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-benzyl-N'-(pyridin-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C15H15N3O2/c19-14(17-10-12-6-2-1-3-7-12)15(20)18-11-13-8-4-5-9-16-13/h1-9H,10-11H2,(H,17,19)(H,18,20) |
| InChIKey | ARZHYMHNHLSUQW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N'-(pyridin-2-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N'-(pyridin-2-ylmethyl)oxamide?
The IUPAC name of N-benzyl-N'-(pyridin-2-ylmethyl)oxamide (CID 3109924) is N-benzyl-N'-(pyridin-2-ylmethyl)oxamide.
What is the SMILES notation for N-benzyl-N'-(pyridin-2-ylmethyl)oxamide?
The canonical SMILES for N-benzyl-N'-(pyridin-2-ylmethyl)oxamide is O=C(NCc1ccccc1)C(=O)NCc1ccccn1.
What is the InChIKey of N-benzyl-N'-(pyridin-2-ylmethyl)oxamide?
The InChIKey is ARZHYMHNHLSUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c19-14(17-10-12-6-2-1-3-7-12)15(20)18-11-13-8-4-5-9-16-13/h1-9H,10-11H2,(H,17,19)(H,18,20).
What are the key properties of N-benzyl-N'-(pyridin-2-ylmethyl)oxamide?
N-benzyl-N'-(pyridin-2-ylmethyl)oxamide has a molecular weight of 269.30 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N'-(pyridin-2-ylmethyl)oxamide is sourced from PubChem (CID 3109924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).