C10H14N4O2 — CID 43315841
N-(2-aminoethyl)-N'-(pyridin-2-ylmethyl)oxamide (PubChem CID 43315841) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N-(2-aminoethyl)-N'-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 43315841 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | N-(2-aminoethyl)-N'-(pyridin-2-ylmethyl)oxamide |
| SMILES | NCCNC(=O)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C10H14N4O2/c11-4-6-13-9(15)10(16)14-7-8-3-1-2-5-12-8/h1-3,5H,4,6-7,11H2,(H,13,15)(H,14,16) |
| InChIKey | ODIHCMSYPFXEIF-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|