C14H19N3O2 — CID 2844203
N'-cyclohexyl-N-(pyridin-2-ylmethyl)oxamide (PubChem CID 2844203) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N'-cyclohexyl-N-(pyridin-2-ylmethyl)oxamide.
| Compound Name | N'-cyclohexyl-N-(pyridin-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 2844203 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N'-cyclohexyl-N-(pyridin-2-ylmethyl)oxamide |
| SMILES | O=C(NCc1ccccn1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H19N3O2/c18-13(16-10-12-8-4-5-9-15-12)14(19)17-11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7,10H2,(H,16,18)(H,17,19) |
| InChIKey | KOJXORBLENEBFI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|