C19H28N4O2 — CID 113004461
1-N-cyclohexyl-4-N-(pyridin-2-ylmethyl)piperidine-1,4-dicarboxamide (PubChem CID 113004461) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-N-(pyridin-2-ylmethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-cyclohexyl-4-N-(pyridin-2-ylmethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 113004461 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-N-cyclohexyl-4-N-(pyridin-2-ylmethyl)piperidine-1,4-dicarboxamide |
| SMILES | O=C(NCc1ccccn1)C1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H28N4O2/c24-18(21-14-17-8-4-5-11-20-17)15-9-12-23(13-10-15)19(25)22-16-6-2-1-3-7-16/h4-5,8,11,15-16H,1-3,6-7,9-10,12-14H2,(H,21,24)(H,22,25) |
| InChIKey | OCDAMMZQELEIJA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |