C13H18N2O4 — CID 17052919
oxalic acid;N-(pyridin-2-ylmethyl)cyclopentanamine (PubChem CID 17052919) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is oxalic acid;N-(pyridin-2-ylmethyl)cyclopentanamine.
| Compound Name | oxalic acid;N-(pyridin-2-ylmethyl)cyclopentanamine |
|---|---|
| PubChem CID | 17052919 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | oxalic acid;N-(pyridin-2-ylmethyl)cyclopentanamine |
| SMILES | O=C(O)C(=O)O.c1ccc(CNC2CCCC2)nc1 |
| InChI | InChI=1S/C11H16N2.C2H2O4/c1-2-6-10(5-1)13-9-11-7-3-4-8-12-11;3-1(4)2(5)6/h3-4,7-8,10,13H,1-2,5-6,9H2;(H,3,4)(H,5,6) |
| InChIKey | LZDONNOKUOTESU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|