C13H21N3 — CID 65071092
1-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine (PubChem CID 65071092) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 1-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine.
| Compound Name | 1-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine |
|---|---|
| PubChem CID | 65071092 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 1-methyl-N-(pyridin-2-ylmethyl)azepan-4-amine |
| SMILES | CN1CCCC(NCc2ccccn2)CC1 |
| InChI | InChI=1S/C13H21N3/c1-16-9-4-6-12(7-10-16)15-11-13-5-2-3-8-14-13/h2-3,5,8,12,15H,4,6-7,9-11H2,1H3 |
| InChIKey | AYRLZPCUMWYMRR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |