C14H17N2O3- — CID 6949299
cis-(1R,2S)-2-(pyridin-2-ylmethylcarbamoyl)cyclohexane-1-carboxylate (PubChem CID 6949299) has the molecular formula C14H17N2O3- and a molecular weight of 261.30 g/mol. Its IUPAC name is cis-(1R,2S)-2-(pyridin-2-ylmethylcarbamoyl)cyclohexane-1-carboxylate.
| Compound Name | cis-(1R,2S)-2-(pyridin-2-ylmethylcarbamoyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 6949299 |
| Molecular Formula | C14H17N2O3- |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | cis-(1R,2S)-2-(pyridin-2-ylmethylcarbamoyl)cyclohexane-1-carboxylate |
| SMILES | O=C(NCc1ccccn1)[C@H]1CCCC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C14H18N2O3/c17-13(16-9-10-5-3-4-8-15-10)11-6-1-2-7-12(11)14(18)19/h3-5,8,11-12H,1-2,6-7,9H2,(H,16,17)(H,18,19)/p-1/t11-,12+/m0/s1 |
| InChIKey | FDGKNNDZRJOOHJ-NWDGAFQWSA-M |
| XLogP | 0.25 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |