C14H13N2O4- — CID 18390325
(1R,2R,3S,4S)-3-(pyridin-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18390325) has the molecular formula C14H13N2O4- and a molecular weight of 273.27 g/mol. Its IUPAC name is (1R,2R,3S,4S)-3-(pyridin-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1R,2R,3S,4S)-3-(pyridin-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18390325 |
| Molecular Formula | C14H13N2O4- |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (1R,2R,3S,4S)-3-(pyridin-2-ylmethylcarbamoyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C([O-])[C@@H]1[C@H](C(=O)NCc2ccccn2)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C14H14N2O4/c17-13(16-7-8-3-1-2-6-15-8)11-9-4-5-10(20-9)12(11)14(18)19/h1-6,9-12H,7H2,(H,16,17)(H,18,19)/p-1/t9-,10+,11+,12-/m0/s1 |
| InChIKey | OPKJEKZXOQTIPV-QCNOEVLYSA-M |
| XLogP | -0.98 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|