C13H16N2O — CID 35511492
(1S)-N-(pyridin-2-ylmethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 35511492) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S)-N-(pyridin-2-ylmethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-(pyridin-2-ylmethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 35511492 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (1S)-N-(pyridin-2-ylmethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCc1ccccn1)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C13H16N2O/c16-13(11-6-2-1-3-7-11)15-10-12-8-4-5-9-14-12/h1-2,4-5,8-9,11H,3,6-7,10H2,(H,15,16)/t11-/m1/s1 |
| InChIKey | RIZWMSXVGXVLLM-LLVKDONJSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|