C15H19NO — CID 42916560
N-[(2-methylphenyl)methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 42916560) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[(2-methylphenyl)methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 42916560 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | N-[(2-methylphenyl)methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C15H19NO/c1-12-7-5-6-10-14(12)11-16-15(17)13-8-3-2-4-9-13/h2-3,5-7,10,13H,4,8-9,11H2,1H3,(H,16,17) |
| InChIKey | KCMVJPQXWTWPGW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|