C18H23NO3 — CID 8566791
[2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate (PubChem CID 8566791) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 8566791 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | [2-[2-(2-methylphenyl)ethylamino]-2-oxoethyl] (1S)-cyclohex-3-ene-1-carboxylate |
| SMILES | Cc1ccccc1CCNC(=O)COC(=O)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C18H23NO3/c1-14-7-5-6-8-15(14)11-12-19-17(20)13-22-18(21)16-9-3-2-4-10-16/h2-3,5-8,16H,4,9-13H2,1H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | AQULBFIQMMOOKP-MRXNPFEDSA-N |
| XLogP | 2.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|