C21H29NO4 — CID 8566829
[2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate (PubChem CID 8566829) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate.
| Compound Name | [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 8566829 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] (1R)-cyclohex-3-ene-1-carboxylate |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)COC(=O)[C@H]2CC=CCC2)cc1 |
| InChI | InChI=1S/C21H29NO4/c1-21(2,3)17-9-11-18(12-10-17)25-14-13-22-19(23)15-26-20(24)16-7-5-4-6-8-16/h4-5,9-12,16H,6-8,13-15H2,1-3H3,(H,22,23)/t16-/m0/s1 |
| InChIKey | QBECTDUGUAVLBQ-INIZCTEOSA-N |
| XLogP | 3.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|