C19H23N3O4 — CID 9196636
[2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 9196636) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 9196636 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [2-[2-(4-tert-butylphenoxy)ethylamino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)COC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C19H23N3O4/c1-19(2,3)14-4-6-15(7-5-14)25-11-10-22-17(23)13-26-18(24)16-12-20-8-9-21-16/h4-9,12H,10-11,13H2,1-3H3,(H,22,23) |
| InChIKey | IUGZPGDFLVFPRR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|