C11H14N4O4 — CID 9196711
[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 9196711) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 9196711 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | CN(C)C(=O)CNC(=O)COC(=O)c1cnccn1 |
| InChI | InChI=1S/C11H14N4O4/c1-15(2)10(17)6-14-9(16)7-19-11(18)8-5-12-3-4-13-8/h3-5H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | MKLSFMVTAYDKHG-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |