C14H20N4O4 — CID 9196523
[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 9196523) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 9196523 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)COC(=O)c1cnccn1 |
| InChI | InChI=1S/C14H20N4O4/c1-14(2,3)17-11(19)8-18(4)12(20)9-22-13(21)10-7-15-5-6-16-10/h5-7H,8-9H2,1-4H3,(H,17,19) |
| InChIKey | BQYZAUCGFPWTAH-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |