C22H26N2O5 — CID 9009280
[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenoxybenzoate (PubChem CID 9009280) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenoxybenzoate.
| Compound Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenoxybenzoate |
|---|---|
| PubChem CID | 9009280 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenoxybenzoate |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)COC(=O)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-22(2,3)23-19(25)14-24(4)20(26)15-28-21(27)16-10-12-18(13-11-16)29-17-8-6-5-7-9-17/h5-13H,14-15H2,1-4H3,(H,23,25) |
| InChIKey | DZTSZEMUUDGWKL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |