C18H25N3O5 — CID 9015926
[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-acetamidobenzoate (PubChem CID 9015926) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-acetamidobenzoate.
| Compound Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 9015926 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)OCC(=O)N(C)CC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O5/c1-12(22)19-14-8-6-13(7-9-14)17(25)26-11-16(24)21(5)10-15(23)20-18(2,3)4/h6-9H,10-11H2,1-5H3,(H,19,22)(H,20,23) |
| InChIKey | NJVJRFAIFWUSJI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |