C16H21ClN2O4 — CID 9014273
[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-chlorobenzoate (PubChem CID 9014273) has the molecular formula C16H21ClN2O4 and a molecular weight of 340.81 g/mol. Its IUPAC name is [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 9014273 |
| Molecular Formula | C16H21ClN2O4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-chlorobenzoate |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)COC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H21ClN2O4/c1-16(2,3)18-13(20)9-19(4)14(21)10-23-15(22)11-6-5-7-12(17)8-11/h5-8H,9-10H2,1-4H3,(H,18,20) |
| InChIKey | FWRSEKVXIJBVRB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |