C23H28N2O5 — CID 8809632
[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenylmethoxybenzoate (PubChem CID 8809632) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenylmethoxybenzoate.
| Compound Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 8809632 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-phenylmethoxybenzoate |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)COC(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-23(2,3)24-20(26)14-25(4)21(27)16-30-22(28)18-10-12-19(13-11-18)29-15-17-8-6-5-7-9-17/h5-13H,14-16H2,1-4H3,(H,24,26) |
| InChIKey | YSTATGPUDICRFD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |