C18H27N3O4 — CID 9228937
[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate (PubChem CID 9228937) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate.
| Compound Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 9228937 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(dimethylamino)benzoate |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)COC(=O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O4/c1-18(2,3)19-15(22)11-21(6)16(23)12-25-17(24)13-7-9-14(10-8-13)20(4)5/h7-10H,11-12H2,1-6H3,(H,19,22) |
| InChIKey | WBFTWOVOHPSLNV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |