C18H22Cl2N2O4 — CID 9018583
[2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 9018583) has the molecular formula C18H22Cl2N2O4 and a molecular weight of 401.29 g/mol. Its IUPAC name is [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9018583 |
| Molecular Formula | C18H22Cl2N2O4 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | [2-[[2-(tert-butylamino)-2-oxoethyl]-methylamino]-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | CN(CC(=O)NC(C)(C)C)C(=O)COC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N2O4/c1-18(2,3)21-15(23)10-22(4)16(24)11-26-17(25)8-6-12-5-7-13(19)9-14(12)20/h5-9H,10-11H2,1-4H3,(H,21,23)/b8-6+ |
| InChIKey | GQCAFHXQSMEXNJ-SOFGYWHQSA-N |
| XLogP | 2.92 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|