C18H13Cl2NO4 — CID 7867816
(2-benzamido-2-oxoethyl) (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 7867816) has the molecular formula C18H13Cl2NO4 and a molecular weight of 378.21 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | (2-benzamido-2-oxoethyl) (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7867816 |
| Molecular Formula | C18H13Cl2NO4 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | (2-benzamido-2-oxoethyl) (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(Cl)cc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H13Cl2NO4/c19-14-8-6-12(15(20)10-14)7-9-17(23)25-11-16(22)21-18(24)13-4-2-1-3-5-13/h1-10H,11H2,(H,21,22,24)/b9-7+ |
| InChIKey | DOGRNZCRQBVFQW-VQHVLOKHSA-N |
| XLogP | 3.51 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|