C25H20Cl2N2O5 — CID 4126741
[2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 4126741) has the molecular formula C25H20Cl2N2O5 and a molecular weight of 499.35 g/mol. Its IUPAC name is [2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4126741 |
| Molecular Formula | C25H20Cl2N2O5 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [2-[4-[(2-methoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | COc1ccccc1NC(=O)c1ccc(NC(=O)COC(=O)C=Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C25H20Cl2N2O5/c1-33-22-5-3-2-4-21(22)29-25(32)17-7-11-19(12-8-17)28-23(30)15-34-24(31)13-9-16-6-10-18(26)14-20(16)27/h2-14H,15H2,1H3,(H,28,30)(H,29,32) |
| InChIKey | GNTQQHMPRLFBIE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|