C18H13Cl2F2NO4 — CID 3423307
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 3423307) has the molecular formula C18H13Cl2F2NO4 and a molecular weight of 416.21 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3423307 |
| Molecular Formula | C18H13Cl2F2NO4 |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(Cl)cc1Cl)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H13Cl2F2NO4/c19-12-7-5-11(13(20)9-12)6-8-17(25)26-10-16(24)23-14-3-1-2-4-15(14)27-18(21)22/h1-9,18H,10H2,(H,23,24) |
| InChIKey | CBOCKVYYYXVENE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|