C19H16Cl2N2O4 — CID 7867860
[2-(4-acetamidoanilino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate (PubChem CID 7867860) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7867860 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] (E)-3-(2,4-dichlorophenyl)prop-2-enoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)/C=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-12(24)22-15-5-7-16(8-6-15)23-18(25)11-27-19(26)9-3-13-2-4-14(20)10-17(13)21/h2-10H,11H2,1H3,(H,22,24)(H,23,25)/b9-3+ |
| InChIKey | CYJDNISLEAMLIN-YCRREMRBSA-N |
| XLogP | 4.15 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|