C18H16Cl2N2O2 — CID 6053257
(E)-3-(2,4-dichlorophenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide (PubChem CID 6053257) has the molecular formula C18H16Cl2N2O2 and a molecular weight of 363.24 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6053257 |
| Molecular Formula | C18H16Cl2N2O2 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(propanoylamino)phenyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1ccc(NC(=O)/C=C/c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N2O2/c1-2-17(23)21-14-6-8-15(9-7-14)22-18(24)10-4-12-3-5-13(19)11-16(12)20/h3-11H,2H2,1H3,(H,21,23)(H,22,24)/b10-4+ |
| InChIKey | ZZPYHLZHVARJAI-ONNFQVAWSA-N |
| XLogP | 4.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|