C14H11Cl2N2O+ — CID 4745023
3-(2,4-dichlorophenyl)-N-pyridin-1-ium-4-ylprop-2-enamide (PubChem CID 4745023) has the molecular formula C14H11Cl2N2O+ and a molecular weight of 294.16 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-pyridin-1-ium-4-ylprop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-pyridin-1-ium-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 4745023 |
| Molecular Formula | C14H11Cl2N2O+ |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-pyridin-1-ium-4-ylprop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Nc1cc[nH+]cc1 |
| InChI | InChI=1S/C14H10Cl2N2O/c15-11-3-1-10(13(16)9-11)2-4-14(19)18-12-5-7-17-8-6-12/h1-9H,(H,17,18,19)/p+1 |
| InChIKey | QZZWNNWWTDQYSY-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 43.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|