C15H10Cl2FNO — CID 872620
(E)-3-(2,4-dichlorophenyl)-N-(3-fluorophenyl)prop-2-enamide (PubChem CID 872620) has the molecular formula C15H10Cl2FNO and a molecular weight of 310.16 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 872620 |
| Molecular Formula | C15H10Cl2FNO |
| Molecular Weight | 310.16 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(3-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H10Cl2FNO/c16-11-6-4-10(14(17)8-11)5-7-15(20)19-13-3-1-2-12(18)9-13/h1-9H,(H,19,20)/b7-5+ |
| InChIKey | GBDDXYXRFXULOF-FNORWQNLSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.16 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|