C19H16Cl2N2O2 — CID 9247195
N-cyclopropyl-3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]benzamide (PubChem CID 9247195) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is N-cyclopropyl-3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]benzamide.
| Compound Name | N-cyclopropyl-3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 9247195 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | N-cyclopropyl-3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]benzamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c20-14-6-4-12(17(21)11-14)5-9-18(24)22-16-3-1-2-13(10-16)19(25)23-15-7-8-15/h1-6,9-11,15H,7-8H2,(H,22,24)(H,23,25)/b9-5+ |
| InChIKey | QQXFGLLFNVPTFS-WEVVVXLNSA-N |
| XLogP | 4.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|