C17H20N2O4 — CID 17170491
(E)-4-[3-(cyclohexylcarbamoyl)anilino]-4-oxobut-2-enoic acid (PubChem CID 17170491) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is (E)-4-[3-(cyclohexylcarbamoyl)anilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-(cyclohexylcarbamoyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 17170491 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (E)-4-[3-(cyclohexylcarbamoyl)anilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C17H20N2O4/c20-15(9-10-16(21)22)18-14-8-4-5-12(11-14)17(23)19-13-6-2-1-3-7-13/h4-5,8-11,13H,1-3,6-7H2,(H,18,20)(H,19,23)(H,21,22)/b10-9+ |
| InChIKey | YBTSPCXWFWSEIE-MDZDMXLPSA-N |
| XLogP | 2.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|