C27H28N2O2 — CID 2239978
N-cyclohexyl-3-[(2,2-diphenylacetyl)amino]benzamide (PubChem CID 2239978) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-cyclohexyl-3-[(2,2-diphenylacetyl)amino]benzamide.
| Compound Name | N-cyclohexyl-3-[(2,2-diphenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 2239978 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-cyclohexyl-3-[(2,2-diphenylacetyl)amino]benzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(NC(=O)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H28N2O2/c30-26(28-23-16-8-3-9-17-23)22-15-10-18-24(19-22)29-27(31)25(20-11-4-1-5-12-20)21-13-6-2-7-14-21/h1-2,4-7,10-15,18-19,23,25H,3,8-9,16-17H2,(H,28,30)(H,29,31) |
| InChIKey | XMPFYSTUCFVSNT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |