C30H34N4O3 — CID 54842054
3-[[2-[3-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide (PubChem CID 54842054) has the molecular formula C30H34N4O3 and a molecular weight of 498.63 g/mol. Its IUPAC name is 3-[[2-[3-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide.
| Compound Name | 3-[[2-[3-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 54842054 |
| Molecular Formula | C30H34N4O3 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 3-[[2-[3-(cyclohexylcarbamoyl)anilino]-2-oxoethyl]amino]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1cccc(NCC(=O)Nc2cccc(C(=O)NC3CCCCC3)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C30H34N4O3/c1-21(22-10-4-2-5-11-22)32-29(36)23-12-8-16-26(18-23)31-20-28(35)33-27-17-9-13-24(19-27)30(37)34-25-14-6-3-7-15-25/h2,4-5,8-13,16-19,21,25,31H,3,6-7,14-15,20H2,1H3,(H,32,36)(H,33,35)(H,34,37) |
| InChIKey | RIFMMNMAIZVTMJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |