C28H30N4O3 — CID 54831035
3-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide (PubChem CID 54831035) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 3-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 54831035 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 3-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide |
| SMILES | O=C(CNc1cccc(C(=O)NC2CCCCC2)c1)Nc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H30N4O3/c33-26(30-24-15-8-16-25(18-24)32-27(34)20-9-3-1-4-10-20)19-29-23-14-7-11-21(17-23)28(35)31-22-12-5-2-6-13-22/h1,3-4,7-11,14-18,22,29H,2,5-6,12-13,19H2,(H,30,33)(H,31,35)(H,32,34) |
| InChIKey | SDDRERORCPELLY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |