C23H28N4O3 — CID 54844186
4-[[2-(3-acetamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide (PubChem CID 54844186) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[[2-(3-acetamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 4-[[2-(3-acetamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 54844186 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 4-[[2-(3-acetamidoanilino)-2-oxoethyl]amino]-N-cyclohexylbenzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)CNc2ccc(C(=O)NC3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-16(28)25-20-8-5-9-21(14-20)26-22(29)15-24-18-12-10-17(11-13-18)23(30)27-19-6-3-2-4-7-19/h5,8-14,19,24H,2-4,6-7,15H2,1H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | AEPGHOHOCRBOAJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |