C25H32N4O3 — CID 54831098
3-[[2-[4-(butanoylamino)anilino]-2-oxoethyl]amino]-N-cyclohexylbenzamide (PubChem CID 54831098) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-[[2-[4-(butanoylamino)anilino]-2-oxoethyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 3-[[2-[4-(butanoylamino)anilino]-2-oxoethyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 54831098 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 3-[[2-[4-(butanoylamino)anilino]-2-oxoethyl]amino]-N-cyclohexylbenzamide |
| SMILES | CCCC(=O)Nc1ccc(NC(=O)CNc2cccc(C(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-2-7-23(30)27-20-12-14-21(15-13-20)28-24(31)17-26-22-11-6-8-18(16-22)25(32)29-19-9-4-3-5-10-19/h6,8,11-16,19,26H,2-5,7,9-10,17H2,1H3,(H,27,30)(H,28,31)(H,29,32) |
| InChIKey | CEEKBJFAXUKVCQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |