C25H31N3O3 — CID 54825740
N-cyclohexyl-4-[[2-[3-(2-methylprop-2-enoxy)anilino]acetyl]amino]benzamide (PubChem CID 54825740) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-cyclohexyl-4-[[2-[3-(2-methylprop-2-enoxy)anilino]acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-4-[[2-[3-(2-methylprop-2-enoxy)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54825740 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-cyclohexyl-4-[[2-[3-(2-methylprop-2-enoxy)anilino]acetyl]amino]benzamide |
| SMILES | C=C(C)COc1cccc(NCC(=O)Nc2ccc(C(=O)NC3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C25H31N3O3/c1-18(2)17-31-23-10-6-9-22(15-23)26-16-24(29)27-21-13-11-19(12-14-21)25(30)28-20-7-4-3-5-8-20/h6,9-15,20,26H,1,3-5,7-8,16-17H2,2H3,(H,27,29)(H,28,30) |
| InChIKey | DCOXSRQFYBOMJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|