C29H33N3O4 — CID 54822775
N-cyclohexyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide (PubChem CID 54822775) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-cyclohexyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 54822775 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-cyclohexyl-3-[[2-[4-(2-phenoxyethoxy)anilino]acetyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(OCCOc2ccccc2)cc1)Nc1cccc(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C29H33N3O4/c33-28(31-25-11-7-8-22(20-25)29(34)32-24-9-3-1-4-10-24)21-30-23-14-16-27(17-15-23)36-19-18-35-26-12-5-2-6-13-26/h2,5-8,11-17,20,24,30H,1,3-4,9-10,18-19,21H2,(H,31,33)(H,32,34) |
| InChIKey | VHNXYQWYXVKVPF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|