C28H29ClN4O3 — CID 54833038
5-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide (PubChem CID 54833038) has the molecular formula C28H29ClN4O3 and a molecular weight of 505.02 g/mol. Its IUPAC name is 5-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide.
| Compound Name | 5-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 54833038 |
| Molecular Formula | C28H29ClN4O3 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 5-[[2-(3-benzamidoanilino)-2-oxoethyl]amino]-2-chloro-N-cyclohexylbenzamide |
| SMILES | O=C(CNc1ccc(Cl)c(C(=O)NC2CCCCC2)c1)Nc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H29ClN4O3/c29-25-15-14-21(17-24(25)28(36)32-20-10-5-2-6-11-20)30-18-26(34)31-22-12-7-13-23(16-22)33-27(35)19-8-3-1-4-9-19/h1,3-4,7-9,12-17,20,30H,2,5-6,10-11,18H2,(H,31,34)(H,32,36)(H,33,35) |
| InChIKey | VZTFBTIJJVTMFS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |